C19H20N6O5 — CID 94074574
3-[4-methyl-2-(4-methylphenyl)-3,5-dioxo-1,2,4-triazin-6-yl]-N-[[(2R)-oxolan-2-yl]methyl]-1,2,4-oxadiazole-5-carboxamide (PubChem CID 94074574) has the molecular formula C19H20N6O5 and a molecular weight of 412.41 g/mol. Its IUPAC name is 3-[4-methyl-2-(4-methylphenyl)-3,5-dioxo-1,2,4-triazin-6-yl]-N-[[(2R)-oxolan-2-yl]methyl]-1,2,4-oxadiazole-5-carboxamide.
| Compound Name | 3-[4-methyl-2-(4-methylphenyl)-3,5-dioxo-1,2,4-triazin-6-yl]-N-[[(2R)-oxolan-2-yl]methyl]-1,2,4-oxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 94074574 |
| Molecular Formula | C19H20N6O5 |
| Molecular Weight | 412.41 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | 3-[4-methyl-2-(4-methylphenyl)-3,5-dioxo-1,2,4-triazin-6-yl]-N-[[(2R)-oxolan-2-yl]methyl]-1,2,4-oxadiazole-5-carboxamide |
| SMILES | Cc1ccc(-n2nc(-c3noc(C(=O)NC[C@H]4CCCO4)n3)c(=O)n(C)c2=O)cc1 |
| InChI | InChI=1S/C19H20N6O5/c1-11-5-7-12(8-6-11)25-19(28)24(2)18(27)14(22-25)15-21-17(30-23-15)16(26)20-10-13-4-3-9-29-13/h5-8,13H,3-4,9-10H2,1-2H3,(H,20,26)/t13-/m1/s1 |
| InChIKey | NZTSXMXIODYVOX-CYBMUJFWSA-N |
| XLogP | 0.20 |
| TPSA | 134.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.41 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |