C23H29N7O4 — CID 94074544
3-[4-ethyl-2-(4-methylphenyl)-3,5-dioxo-1,2,4-triazin-6-yl]-N-[2-[(2R)-2-methylpiperidin-1-yl]ethyl]-1,2,4-oxadiazole-5-carboxamide (PubChem CID 94074544) has the molecular formula C23H29N7O4 and a molecular weight of 467.53 g/mol. Its IUPAC name is 3-[4-ethyl-2-(4-methylphenyl)-3,5-dioxo-1,2,4-triazin-6-yl]-N-[2-[(2R)-2-methylpiperidin-1-yl]ethyl]-1,2,4-oxadiazole-5-carboxamide.
| Compound Name | 3-[4-ethyl-2-(4-methylphenyl)-3,5-dioxo-1,2,4-triazin-6-yl]-N-[2-[(2R)-2-methylpiperidin-1-yl]ethyl]-1,2,4-oxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 94074544 |
| Molecular Formula | C23H29N7O4 |
| Molecular Weight | 467.53 g/mol |
| Exact Mass | 467.23 |
| IUPAC Name | 3-[4-ethyl-2-(4-methylphenyl)-3,5-dioxo-1,2,4-triazin-6-yl]-N-[2-[(2R)-2-methylpiperidin-1-yl]ethyl]-1,2,4-oxadiazole-5-carboxamide |
| SMILES | CCn1c(=O)c(-c2noc(C(=O)NCCN3CCCC[C@H]3C)n2)nn(-c2ccc(C)cc2)c1=O |
| InChI | InChI=1S/C23H29N7O4/c1-4-29-22(32)18(26-30(23(29)33)17-10-8-15(2)9-11-17)19-25-21(34-27-19)20(31)24-12-14-28-13-6-5-7-16(28)3/h8-11,16H,4-7,12-14H2,1-3H3,(H,24,31)/t16-/m1/s1 |
| InChIKey | QUIKLVDIUKWTMW-MRXNPFEDSA-N |
| XLogP | 1.38 |
| TPSA | 128.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.53 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |