C26H16N8O4+2 — CID 76793666
7,17-dimethyl-2,12-diphenyl-4,7,10,14,17,20-hexaza-2,12-diazoniapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1,3,5(9),10,12,14,19-heptaene-6,8,16,18-tetrone (PubChem CID 76793666) has the molecular formula C26H16N8O4+2 and a molecular weight of 504.47 g/mol. Its IUPAC name is 7,17-dimethyl-2,12-diphenyl-4,7,10,14,17,20-hexaza-2,12-diazoniapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1,3,5(9),10,12,14,19-heptaene-6,8,16,18-tetrone.
| Compound Name | 7,17-dimethyl-2,12-diphenyl-4,7,10,14,17,20-hexaza-2,12-diazoniapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1,3,5(9),10,12,14,19-heptaene-6,8,16,18-tetrone |
|---|---|
| PubChem CID | 76793666 |
| Molecular Formula | C26H16N8O4+2 |
| Molecular Weight | 504.47 g/mol |
| Exact Mass | 504.13 |
| IUPAC Name | 7,17-dimethyl-2,12-diphenyl-4,7,10,14,17,20-hexaza-2,12-diazoniapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1,3,5(9),10,12,14,19-heptaene-6,8,16,18-tetrone |
| SMILES | Cn1c(=O)c2nc3c(nc2c1=O)[n+](-c1ccccc1)c1nc2c(=O)n(C)c(=O)c2nc1[n+]3-c1ccccc1 |
| InChI | InChI=1S/C26H16N8O4/c1-31-23(35)15-16(24(31)36)28-20-19(27-15)33(13-9-5-3-6-10-13)21-22(34(20)14-11-7-4-8-12-14)30-18-17(29-21)25(37)32(2)26(18)38/h3-12H,1-2H3/q+2 |
| InChIKey | QAUAREQQJRVLOY-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 137.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.47 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|