C25H13N9O2+2 — CID 76793682
5,6-diisocyano-14-methyl-2,9-diphenyl-4,7,11,14,17-pentaza-2,9-diazoniatetracyclo[8.7.0.03,8.012,16]heptadeca-1(17),2,4,6,8,10,12(16)-heptaene-13,15-dione (PubChem CID 76793682) has the molecular formula C25H13N9O2+2 and a molecular weight of 471.44 g/mol. Its IUPAC name is 5,6-diisocyano-14-methyl-2,9-diphenyl-4,7,11,14,17-pentaza-2,9-diazoniatetracyclo[8.7.0.03,8.012,16]heptadeca-1(17),2,4,6,8,10,12(16)-heptaene-13,15-dione.
| Compound Name | 5,6-diisocyano-14-methyl-2,9-diphenyl-4,7,11,14,17-pentaza-2,9-diazoniatetracyclo[8.7.0.03,8.012,16]heptadeca-1(17),2,4,6,8,10,12(16)-heptaene-13,15-dione |
|---|---|
| PubChem CID | 76793682 |
| Molecular Formula | C25H13N9O2+2 |
| Molecular Weight | 471.44 g/mol |
| Exact Mass | 471.12 |
| IUPAC Name | 5,6-diisocyano-14-methyl-2,9-diphenyl-4,7,11,14,17-pentaza-2,9-diazoniatetracyclo[8.7.0.03,8.012,16]heptadeca-1(17),2,4,6,8,10,12(16)-heptaene-13,15-dione |
| SMILES | [C-]#[N+]c1nc2c(nc1[N+]#[C-])[n+](-c1ccccc1)c1nc3c(nc1[n+]2-c1ccccc1)C(=O)N(C)C3=O |
| InChI | InChI=1S/C25H13N9O2/c1-26-18-19(27-2)31-23-22(30-18)33(14-10-6-4-7-11-14)20-21(34(23)15-12-8-5-9-13-15)29-17-16(28-20)24(35)32(3)25(17)36/h4-13H,3H3/q+2 |
| InChIKey | TZVLBDSORPZQDU-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 105.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.44 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|