C10H7N4O+ — CID 20783542
2-phenylimidazo[5,1-c][1,2,4]triazol-2-ium-3-one (PubChem CID 20783542) has the molecular formula C10H7N4O+ and a molecular weight of 199.19 g/mol. Its IUPAC name is 2-phenylimidazo[5,1-c][1,2,4]triazol-2-ium-3-one.
| Compound Name | 2-phenylimidazo[5,1-c][1,2,4]triazol-2-ium-3-one |
|---|---|
| PubChem CID | 20783542 |
| Molecular Formula | C10H7N4O+ |
| Molecular Weight | 199.19 g/mol |
| Exact Mass | 199.06 |
| IUPAC Name | 2-phenylimidazo[5,1-c][1,2,4]triazol-2-ium-3-one |
| SMILES | O=C1n2cncc2N=[N+]1c1ccccc1 |
| InChI | InChI=1S/C10H7N4O/c15-10-13-7-11-6-9(13)12-14(10)8-4-2-1-3-5-8/h1-7H/q+1 |
| InChIKey | ZERLFVQMZXFANQ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 50.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.19 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|