C20H16N3O+ — CID 134871110
2,5,5-triphenyl-4H-1,2,4-triazol-2-ium-3-one (PubChem CID 134871110) has the molecular formula C20H16N3O+ and a molecular weight of 314.37 g/mol. Its IUPAC name is 2,5,5-triphenyl-4H-1,2,4-triazol-2-ium-3-one.
| Compound Name | 2,5,5-triphenyl-4H-1,2,4-triazol-2-ium-3-one |
|---|---|
| PubChem CID | 134871110 |
| Molecular Formula | C20H16N3O+ |
| Molecular Weight | 314.37 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | 2,5,5-triphenyl-4H-1,2,4-triazol-2-ium-3-one |
| SMILES | O=C1NC(c2ccccc2)(c2ccccc2)N=[N+]1c1ccccc1 |
| InChI | InChI=1S/C20H15N3O/c24-19-21-20(16-10-4-1-5-11-16,17-12-6-2-7-13-17)22-23(19)18-14-8-3-9-15-18/h1-15H/p+1 |
| InChIKey | NSKGRHSWPKVCOO-UHFFFAOYSA-O |
| XLogP | 4.41 |
| TPSA | 44.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.37 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|