C10H10N2S2 — CID 3038265
5-methyl-5-phenylimidazolidine-2,4-dithione (PubChem CID 3038265) has the molecular formula C10H10N2S2 and a molecular weight of 222.34 g/mol. Its IUPAC name is 5-methyl-5-phenylimidazolidine-2,4-dithione.
| Compound Name | 5-methyl-5-phenylimidazolidine-2,4-dithione |
|---|---|
| PubChem CID | 3038265 |
| Molecular Formula | C10H10N2S2 |
| Molecular Weight | 222.34 g/mol |
| Exact Mass | 222.03 |
| IUPAC Name | 5-methyl-5-phenylimidazolidine-2,4-dithione |
| SMILES | CC1(c2ccccc2)NC(=S)NC1=S |
| InChI | InChI=1S/C10H10N2S2/c1-10(7-5-3-2-4-6-7)8(13)11-9(14)12-10/h2-6H,1H3,(H2,11,12,13,14) |
| InChIKey | YOWDYUCYCIRBSF-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.34 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|