C30H14N8O2 — CID 58462193
7,8-diisocyano-4,11-diphenyl-2,4,6,9,11,13-hexazapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(14),2,5,7,9,12,16,18,20-nonaene-15,22-dione (PubChem CID 58462193) has the molecular formula C30H14N8O2 and a molecular weight of 518.50 g/mol. Its IUPAC name is 7,8-diisocyano-4,11-diphenyl-2,4,6,9,11,13-hexazapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(14),2,5,7,9,12,16,18,20-nonaene-15,22-dione.
| Compound Name | 7,8-diisocyano-4,11-diphenyl-2,4,6,9,11,13-hexazapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(14),2,5,7,9,12,16,18,20-nonaene-15,22-dione |
|---|---|
| PubChem CID | 58462193 |
| Molecular Formula | C30H14N8O2 |
| Molecular Weight | 518.50 g/mol |
| Exact Mass | 518.12 |
| IUPAC Name | 7,8-diisocyano-4,11-diphenyl-2,4,6,9,11,13-hexazapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(14),2,5,7,9,12,16,18,20-nonaene-15,22-dione |
| SMILES | [C-]#[N+]c1nc2c(nc1[N+]#[C-])n(-c1ccccc1)c1nc3c(=O)c4ccccc4c(=O)c3nc1n2-c1ccccc1 |
| InChI | InChI=1S/C30H14N8O2/c1-31-25-26(32-2)36-30-29(35-25)37(17-11-5-3-6-12-17)27-28(38(30)18-13-7-4-8-14-18)34-22-21(33-27)23(39)19-15-9-10-16-20(19)24(22)40/h3-16H |
| InChIKey | YUFBTZJOGIFXNP-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 104.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.50 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|