C30H15N5 — CID 140956308
10,11-diisocyano-22-phenyl-9,12,22-triazahexacyclo[12.11.0.02,7.08,13.015,23.016,21]pentacosa-1(14),2,4,6,8(13),9,11,15(23),16,18,20,24-dodecaene (PubChem CID 140956308) has the molecular formula C30H15N5 and a molecular weight of 445.49 g/mol. Its IUPAC name is 10,11-diisocyano-22-phenyl-9,12,22-triazahexacyclo[12.11.0.02,7.08,13.015,23.016,21]pentacosa-1(14),2,4,6,8(13),9,11,15(23),16,18,20,24-dodecaene.
| Compound Name | 10,11-diisocyano-22-phenyl-9,12,22-triazahexacyclo[12.11.0.02,7.08,13.015,23.016,21]pentacosa-1(14),2,4,6,8(13),9,11,15(23),16,18,20,24-dodecaene |
|---|---|
| PubChem CID | 140956308 |
| Molecular Formula | C30H15N5 |
| Molecular Weight | 445.49 g/mol |
| Exact Mass | 445.13 |
| IUPAC Name | 10,11-diisocyano-22-phenyl-9,12,22-triazahexacyclo[12.11.0.02,7.08,13.015,23.016,21]pentacosa-1(14),2,4,6,8(13),9,11,15(23),16,18,20,24-dodecaene |
| SMILES | [C-]#[N+]c1nc2c3ccccc3c3ccc4c(c5ccccc5n4-c4ccccc4)c3c2nc1[N+]#[C-] |
| InChI | InChI=1S/C30H15N5/c1-31-29-30(32-2)34-28-26-20(19-12-6-7-13-21(19)27(28)33-29)16-17-24-25(26)22-14-8-9-15-23(22)35(24)18-10-4-3-5-11-18/h3-17H |
| InChIKey | RAAGSJWUGHDTPL-UHFFFAOYSA-N |
| XLogP | 8.13 |
| TPSA | 39.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.49 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|