C47H29N5 — CID 163950415
6-(5-isocyano-2,6-diphenylpyrimidin-4-yl)-9,14-diphenyl-9,14-diazapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1(13),2(10),3(8),4,6,11,15,17,19-nonaene (PubChem CID 163950415) has the molecular formula C47H29N5 and a molecular weight of 663.78 g/mol. Its IUPAC name is 6-(5-isocyano-2,6-diphenylpyrimidin-4-yl)-9,14-diphenyl-9,14-diazapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1(13),2(10),3(8),4,6,11,15,17,19-nonaene.
| Compound Name | 6-(5-isocyano-2,6-diphenylpyrimidin-4-yl)-9,14-diphenyl-9,14-diazapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1(13),2(10),3(8),4,6,11,15,17,19-nonaene |
|---|---|
| PubChem CID | 163950415 |
| Molecular Formula | C47H29N5 |
| Molecular Weight | 663.78 g/mol |
| Exact Mass | 663.24 |
| IUPAC Name | 6-(5-isocyano-2,6-diphenylpyrimidin-4-yl)-9,14-diphenyl-9,14-diazapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1(13),2(10),3(8),4,6,11,15,17,19-nonaene |
| SMILES | [C-]#[N+]c1c(-c2ccccc2)nc(-c2ccccc2)nc1-c1ccc2c3c4c5ccccc5n(-c5ccccc5)c4ccc3n(-c3ccccc3)c2c1 |
| InChI | InChI=1S/C47H29N5/c1-48-46-44(31-16-6-2-7-17-31)49-47(32-18-8-3-9-19-32)50-45(46)33-26-27-37-41(30-33)52(35-22-12-5-13-23-35)40-29-28-39-42(43(37)40)36-24-14-15-25-38(36)51(39)34-20-10-4-11-21-34/h2-30H |
| InChIKey | ZXHHCRAWOMGCEI-UHFFFAOYSA-N |
| XLogP | 12.22 |
| TPSA | 40.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.78 |
| LogP ≤ 5 | 12.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|