C17H10ClN3O — CID 146647879
2-chloro-5-phenylpyrazino[2,3-c]isoquinolin-6-one (PubChem CID 146647879) has the molecular formula C17H10ClN3O and a molecular weight of 307.74 g/mol. Its IUPAC name is 2-chloro-5-phenylpyrazino[2,3-c]isoquinolin-6-one.
| Compound Name | 2-chloro-5-phenylpyrazino[2,3-c]isoquinolin-6-one |
|---|---|
| PubChem CID | 146647879 |
| Molecular Formula | C17H10ClN3O |
| Molecular Weight | 307.74 g/mol |
| Exact Mass | 307.05 |
| IUPAC Name | 2-chloro-5-phenylpyrazino[2,3-c]isoquinolin-6-one |
| SMILES | O=c1c2ccccc2c2nc(Cl)cnc2n1-c1ccccc1 |
| InChI | InChI=1S/C17H10ClN3O/c18-14-10-19-16-15(20-14)12-8-4-5-9-13(12)17(22)21(16)11-6-2-1-3-7-11/h1-10H |
| InChIKey | FGOPREANPXUIIN-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.74 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|