C24H17N3OS — CID 146597154
2-methylsulfanyl-4,5-diphenylpyrimido[5,4-c]isoquinolin-6-one (PubChem CID 146597154) has the molecular formula C24H17N3OS and a molecular weight of 395.49 g/mol. Its IUPAC name is 2-methylsulfanyl-4,5-diphenylpyrimido[5,4-c]isoquinolin-6-one.
| Compound Name | 2-methylsulfanyl-4,5-diphenylpyrimido[5,4-c]isoquinolin-6-one |
|---|---|
| PubChem CID | 146597154 |
| Molecular Formula | C24H17N3OS |
| Molecular Weight | 395.49 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | 2-methylsulfanyl-4,5-diphenylpyrimido[5,4-c]isoquinolin-6-one |
| SMILES | CSc1nc(-c2ccccc2)c2c(n1)c1ccccc1c(=O)n2-c1ccccc1 |
| InChI | InChI=1S/C24H17N3OS/c1-29-24-25-20(16-10-4-2-5-11-16)22-21(26-24)18-14-8-9-15-19(18)23(28)27(22)17-12-6-3-7-13-17/h2-15H,1H3 |
| InChIKey | BAWGRSJNGSTOSO-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.49 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|