C44H29N5 — CID 122628688
2-[3-(4,6-diphenylpyrimidin-2-yl)phenyl]-4,5-diphenylpyrimido[5,4-b]indole (PubChem CID 122628688) has the molecular formula C44H29N5 and a molecular weight of 627.75 g/mol. Its IUPAC name is 2-[3-(4,6-diphenylpyrimidin-2-yl)phenyl]-4,5-diphenylpyrimido[5,4-b]indole.
| Compound Name | 2-[3-(4,6-diphenylpyrimidin-2-yl)phenyl]-4,5-diphenylpyrimido[5,4-b]indole |
|---|---|
| PubChem CID | 122628688 |
| Molecular Formula | C44H29N5 |
| Molecular Weight | 627.75 g/mol |
| Exact Mass | 627.24 |
| IUPAC Name | 2-[3-(4,6-diphenylpyrimidin-2-yl)phenyl]-4,5-diphenylpyrimido[5,4-b]indole |
| SMILES | c1ccc(-c2cc(-c3ccccc3)nc(-c3cccc(-c4nc(-c5ccccc5)c5c(n4)c4ccccc4n5-c4ccccc4)c3)n2)cc1 |
| InChI | InChI=1S/C44H29N5/c1-5-16-30(17-6-1)37-29-38(31-18-7-2-8-19-31)46-43(45-37)33-22-15-23-34(28-33)44-47-40(32-20-9-3-10-21-32)42-41(48-44)36-26-13-14-27-39(36)49(42)35-24-11-4-12-25-35/h1-29H |
| InChIKey | JHRBITFBKGGZER-UHFFFAOYSA-N |
| XLogP | 10.70 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.75 |
| LogP ≤ 5 | 10.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |