C52H37N3Si — CID 140763876
[3-[3-(4,5-diphenylpyrimido[5,4-b]indol-2-yl)phenyl]phenyl]-triphenylsilane (PubChem CID 140763876) has the molecular formula C52H37N3Si and a molecular weight of 731.98 g/mol. Its IUPAC name is [3-[3-(4,5-diphenylpyrimido[5,4-b]indol-2-yl)phenyl]phenyl]-triphenylsilane.
| Compound Name | [3-[3-(4,5-diphenylpyrimido[5,4-b]indol-2-yl)phenyl]phenyl]-triphenylsilane |
|---|---|
| PubChem CID | 140763876 |
| Molecular Formula | C52H37N3Si |
| Molecular Weight | 731.98 g/mol |
| Exact Mass | 731.28 |
| IUPAC Name | [3-[3-(4,5-diphenylpyrimido[5,4-b]indol-2-yl)phenyl]phenyl]-triphenylsilane |
| SMILES | c1ccc(-c2nc(-c3cccc(-c4cccc([Si](c5ccccc5)(c5ccccc5)c5ccccc5)c4)c3)nc3c4ccccc4n(-c4ccccc4)c23)cc1 |
| InChI | InChI=1S/C52H37N3Si/c1-6-20-38(21-7-1)49-51-50(47-34-16-17-35-48(47)55(51)42-25-8-2-9-26-42)54-52(53-49)41-24-18-22-39(36-41)40-23-19-33-46(37-40)56(43-27-10-3-11-28-43,44-29-12-4-13-30-44)45-31-14-5-15-32-45/h1-37H |
| InChIKey | YBAYODUNASVUMS-UHFFFAOYSA-N |
| XLogP | 9.95 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.98 |
| LogP ≤ 5 | 9.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|