C24H11N5 — CID 140956006
13,14-diisocyano-10,12,15-triazahexacyclo[15.8.0.02,10.04,9.011,16.018,23]pentacosa-1(17),2,4,6,8,11(16),12,14,18,20,22,24-dodecaene (PubChem CID 140956006) has the molecular formula C24H11N5 and a molecular weight of 369.39 g/mol. Its IUPAC name is 13,14-diisocyano-10,12,15-triazahexacyclo[15.8.0.02,10.04,9.011,16.018,23]pentacosa-1(17),2,4,6,8,11(16),12,14,18,20,22,24-dodecaene.
| Compound Name | 13,14-diisocyano-10,12,15-triazahexacyclo[15.8.0.02,10.04,9.011,16.018,23]pentacosa-1(17),2,4,6,8,11(16),12,14,18,20,22,24-dodecaene |
|---|---|
| PubChem CID | 140956006 |
| Molecular Formula | C24H11N5 |
| Molecular Weight | 369.39 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | 13,14-diisocyano-10,12,15-triazahexacyclo[15.8.0.02,10.04,9.011,16.018,23]pentacosa-1(17),2,4,6,8,11(16),12,14,18,20,22,24-dodecaene |
| SMILES | [C-]#[N+]c1nc2c3c4ccccc4ccc3c3cc4ccccc4n3c2nc1[N+]#[C-] |
| InChI | InChI=1S/C24H11N5/c1-25-22-23(26-2)28-24-21(27-22)20-16-9-5-3-7-14(16)11-12-17(20)19-13-15-8-4-6-10-18(15)29(19)24/h3-13H |
| InChIKey | WLDKITBEINXUJR-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 38.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.39 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|