C26H13N3 — CID 140955971
13,14-diisocyano-10-azahexacyclo[15.8.0.02,10.04,9.011,16.020,25]pentacosa-1(17),2,4,6,8,11,13,15,18,20,22,24-dodecaene (PubChem CID 140955971) has the molecular formula C26H13N3 and a molecular weight of 367.41 g/mol. Its IUPAC name is 13,14-diisocyano-10-azahexacyclo[15.8.0.02,10.04,9.011,16.020,25]pentacosa-1(17),2,4,6,8,11,13,15,18,20,22,24-dodecaene.
| Compound Name | 13,14-diisocyano-10-azahexacyclo[15.8.0.02,10.04,9.011,16.020,25]pentacosa-1(17),2,4,6,8,11,13,15,18,20,22,24-dodecaene |
|---|---|
| PubChem CID | 140955971 |
| Molecular Formula | C26H13N3 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | 13,14-diisocyano-10-azahexacyclo[15.8.0.02,10.04,9.011,16.020,25]pentacosa-1(17),2,4,6,8,11,13,15,18,20,22,24-dodecaene |
| SMILES | [C-]#[N+]c1cc2c3ccc4ccccc4c3c3cc4ccccc4n3c2cc1[N+]#[C-] |
| InChI | InChI=1S/C26H13N3/c1-27-21-14-20-19-12-11-16-7-3-5-9-18(16)26(19)25-13-17-8-4-6-10-23(17)29(25)24(20)15-22(21)28-2/h3-15H |
| InChIKey | MOJLOOOXIIJVBL-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 13.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|