C27H12N4 — CID 140956197
13,14,15-triisocyano-10-azahexacyclo[15.8.0.02,10.04,9.011,16.019,24]pentacosa-1(25),2,4,6,8,11(16),12,14,17,19,21,23-dodecaene (PubChem CID 140956197) has the molecular formula C27H12N4 and a molecular weight of 392.42 g/mol. Its IUPAC name is 13,14,15-triisocyano-10-azahexacyclo[15.8.0.02,10.04,9.011,16.019,24]pentacosa-1(25),2,4,6,8,11(16),12,14,17,19,21,23-dodecaene.
| Compound Name | 13,14,15-triisocyano-10-azahexacyclo[15.8.0.02,10.04,9.011,16.019,24]pentacosa-1(25),2,4,6,8,11(16),12,14,17,19,21,23-dodecaene |
|---|---|
| PubChem CID | 140956197 |
| Molecular Formula | C27H12N4 |
| Molecular Weight | 392.42 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | 13,14,15-triisocyano-10-azahexacyclo[15.8.0.02,10.04,9.011,16.019,24]pentacosa-1(25),2,4,6,8,11(16),12,14,17,19,21,23-dodecaene |
| SMILES | [C-]#[N+]c1cc2c(c([N+]#[C-])c1[N+]#[C-])c1cc3ccccc3cc1c1cc3ccccc3n12 |
| InChI | InChI=1S/C27H12N4/c1-28-21-15-24-25(27(30-3)26(21)29-2)20-13-17-9-5-4-8-16(17)12-19(20)23-14-18-10-6-7-11-22(18)31(23)24/h4-15H |
| InChIKey | BMLNCPQVPAFVFA-UHFFFAOYSA-N |
| XLogP | 8.20 |
| TPSA | 17.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.42 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|