C15H15BrN4O2 — CID 24685573
8-bromo-1,3-dimethyl-9-(2-phenylethyl)purine-2,6-dione (PubChem CID 24685573) has the molecular formula C15H15BrN4O2 and a molecular weight of 363.22 g/mol. Its IUPAC name is 8-bromo-1,3-dimethyl-9-(2-phenylethyl)purine-2,6-dione.
| Compound Name | 8-bromo-1,3-dimethyl-9-(2-phenylethyl)purine-2,6-dione |
|---|---|
| PubChem CID | 24685573 |
| Molecular Formula | C15H15BrN4O2 |
| Molecular Weight | 363.22 g/mol |
| Exact Mass | 362.04 |
| IUPAC Name | 8-bromo-1,3-dimethyl-9-(2-phenylethyl)purine-2,6-dione |
| SMILES | Cn1c(=O)c2nc(Br)n(CCc3ccccc3)c2n(C)c1=O |
| InChI | InChI=1S/C15H15BrN4O2/c1-18-12-11(13(21)19(2)15(18)22)17-14(16)20(12)9-8-10-6-4-3-5-7-10/h3-7H,8-9H2,1-2H3 |
| InChIKey | USBSEMMYGOWVMY-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 61.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.22 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |