C11H11BrCl2N4O2 — CID 16617272
8-bromo-9-[(2,2-dichlorocyclopropyl)methyl]-1,3-dimethylpurine-2,6-dione (PubChem CID 16617272) has the molecular formula C11H11BrCl2N4O2 and a molecular weight of 382.05 g/mol. Its IUPAC name is 8-bromo-9-[(2,2-dichlorocyclopropyl)methyl]-1,3-dimethylpurine-2,6-dione.
| Compound Name | 8-bromo-9-[(2,2-dichlorocyclopropyl)methyl]-1,3-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 16617272 |
| Molecular Formula | C11H11BrCl2N4O2 |
| Molecular Weight | 382.05 g/mol |
| Exact Mass | 379.94 |
| IUPAC Name | 8-bromo-9-[(2,2-dichlorocyclopropyl)methyl]-1,3-dimethylpurine-2,6-dione |
| SMILES | Cn1c(=O)c2nc(Br)n(CC3CC3(Cl)Cl)c2n(C)c1=O |
| InChI | InChI=1S/C11H11BrCl2N4O2/c1-16-7-6(8(19)17(2)10(16)20)15-9(12)18(7)4-5-3-11(5,13)14/h5H,3-4H2,1-2H3 |
| InChIKey | GKCFDGLNZLYHOR-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 61.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.05 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|