C14H11BrCl2N4O2 — CID 39533757
8-bromo-9-[(2,6-dichlorophenyl)methyl]-1,3-dimethylpurine-2,6-dione (PubChem CID 39533757) has the molecular formula C14H11BrCl2N4O2 and a molecular weight of 418.08 g/mol. Its IUPAC name is 8-bromo-9-[(2,6-dichlorophenyl)methyl]-1,3-dimethylpurine-2,6-dione.
| Compound Name | 8-bromo-9-[(2,6-dichlorophenyl)methyl]-1,3-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 39533757 |
| Molecular Formula | C14H11BrCl2N4O2 |
| Molecular Weight | 418.08 g/mol |
| Exact Mass | 415.94 |
| IUPAC Name | 8-bromo-9-[(2,6-dichlorophenyl)methyl]-1,3-dimethylpurine-2,6-dione |
| SMILES | Cn1c(=O)c2nc(Br)n(Cc3c(Cl)cccc3Cl)c2n(C)c1=O |
| InChI | InChI=1S/C14H11BrCl2N4O2/c1-19-11-10(12(22)20(2)14(19)23)18-13(15)21(11)6-7-8(16)4-3-5-9(7)17/h3-5H,6H2,1-2H3 |
| InChIKey | IUXINMPDFAKHFN-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 61.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.08 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |