C10H13BrN4O3 — CID 111126928
8-bromo-9-(3-hydroxypropyl)-1,3-dimethylpurine-2,6-dione (PubChem CID 111126928) has the molecular formula C10H13BrN4O3 and a molecular weight of 317.14 g/mol. Its IUPAC name is 8-bromo-9-(3-hydroxypropyl)-1,3-dimethylpurine-2,6-dione.
| Compound Name | 8-bromo-9-(3-hydroxypropyl)-1,3-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 111126928 |
| Molecular Formula | C10H13BrN4O3 |
| Molecular Weight | 317.14 g/mol |
| Exact Mass | 316.02 |
| IUPAC Name | 8-bromo-9-(3-hydroxypropyl)-1,3-dimethylpurine-2,6-dione |
| SMILES | Cn1c(=O)c2nc(Br)n(CCCO)c2n(C)c1=O |
| InChI | InChI=1S/C10H13BrN4O3/c1-13-7-6(8(17)14(2)10(13)18)12-9(11)15(7)4-3-5-16/h16H,3-5H2,1-2H3 |
| InChIKey | TZNKKWNFMKQZTR-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 82.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.14 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |