C9H11BrN4O2 — CID 82463686
8-(bromomethyl)-1,3,9-trimethylpurine-2,6-dione (PubChem CID 82463686) has the molecular formula C9H11BrN4O2 and a molecular weight of 287.12 g/mol. Its IUPAC name is 8-(bromomethyl)-1,3,9-trimethylpurine-2,6-dione.
| Compound Name | 8-(bromomethyl)-1,3,9-trimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 82463686 |
| Molecular Formula | C9H11BrN4O2 |
| Molecular Weight | 287.12 g/mol |
| Exact Mass | 286.01 |
| IUPAC Name | 8-(bromomethyl)-1,3,9-trimethylpurine-2,6-dione |
| SMILES | Cn1c(=O)c2nc(CBr)n(C)c2n(C)c1=O |
| InChI | InChI=1S/C9H11BrN4O2/c1-12-5(4-10)11-6-7(12)13(2)9(16)14(3)8(6)15/h4H2,1-3H3 |
| InChIKey | MCPGWAIRSNOECT-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 61.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.12 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|