C14H22N6O2 — CID 82463713
9-ethyl-1,3-dimethyl-8-(piperazin-1-ylmethyl)purine-2,6-dione (PubChem CID 82463713) has the molecular formula C14H22N6O2 and a molecular weight of 306.37 g/mol. Its IUPAC name is 9-ethyl-1,3-dimethyl-8-(piperazin-1-ylmethyl)purine-2,6-dione.
| Compound Name | 9-ethyl-1,3-dimethyl-8-(piperazin-1-ylmethyl)purine-2,6-dione |
|---|---|
| PubChem CID | 82463713 |
| Molecular Formula | C14H22N6O2 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | 9-ethyl-1,3-dimethyl-8-(piperazin-1-ylmethyl)purine-2,6-dione |
| SMILES | CCn1c(CN2CCNCC2)nc2c(=O)n(C)c(=O)n(C)c21 |
| InChI | InChI=1S/C14H22N6O2/c1-4-20-10(9-19-7-5-15-6-8-19)16-11-12(20)17(2)14(22)18(3)13(11)21/h15H,4-9H2,1-3H3 |
| InChIKey | RJADHRXMUQKVSD-UHFFFAOYSA-N |
| XLogP | -1.14 |
| TPSA | 77.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |