C13H19N5 — CID 63757473
3-ethyl-2-(piperazin-1-ylmethyl)imidazo[4,5-b]pyridine (PubChem CID 63757473) has the molecular formula C13H19N5 and a molecular weight of 245.33 g/mol. Its IUPAC name is 3-ethyl-2-(piperazin-1-ylmethyl)imidazo[4,5-b]pyridine.
| Compound Name | 3-ethyl-2-(piperazin-1-ylmethyl)imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 63757473 |
| Molecular Formula | C13H19N5 |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.16 |
| IUPAC Name | 3-ethyl-2-(piperazin-1-ylmethyl)imidazo[4,5-b]pyridine |
| SMILES | CCn1c(CN2CCNCC2)nc2cccnc21 |
| InChI | InChI=1S/C13H19N5/c1-2-18-12(10-17-8-6-14-7-9-17)16-11-4-3-5-15-13(11)18/h3-5,14H,2,6-10H2,1H3 |
| InChIKey | CJQOTYTTZLHWPK-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |