C11H17N5O2 — CID 82463788
8-amino-9-butyl-1,3-dimethylpurine-2,6-dione (PubChem CID 82463788) has the molecular formula C11H17N5O2 and a molecular weight of 251.29 g/mol. Its IUPAC name is 8-amino-9-butyl-1,3-dimethylpurine-2,6-dione.
| Compound Name | 8-amino-9-butyl-1,3-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 82463788 |
| Molecular Formula | C11H17N5O2 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | 8-amino-9-butyl-1,3-dimethylpurine-2,6-dione |
| SMILES | CCCCn1c(N)nc2c(=O)n(C)c(=O)n(C)c21 |
| InChI | InChI=1S/C11H17N5O2/c1-4-5-6-16-8-7(13-10(16)12)9(17)15(3)11(18)14(8)2/h4-6H2,1-3H3,(H2,12,13) |
| InChIKey | ICTBAEJROAMLCT-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 87.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |