C12H16N4O4 — CID 82463679
4-(1,3,9-trimethyl-2,6-dioxopurin-8-yl)butanoic acid (PubChem CID 82463679) has the molecular formula C12H16N4O4 and a molecular weight of 280.28 g/mol. Its IUPAC name is 4-(1,3,9-trimethyl-2,6-dioxopurin-8-yl)butanoic acid.
| Compound Name | 4-(1,3,9-trimethyl-2,6-dioxopurin-8-yl)butanoic acid |
|---|---|
| PubChem CID | 82463679 |
| Molecular Formula | C12H16N4O4 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 4-(1,3,9-trimethyl-2,6-dioxopurin-8-yl)butanoic acid |
| SMILES | Cn1c(=O)c2nc(CCCC(=O)O)n(C)c2n(C)c1=O |
| InChI | InChI=1S/C12H16N4O4/c1-14-7(5-4-6-8(17)18)13-9-10(14)15(2)12(20)16(3)11(9)19/h4-6H2,1-3H3,(H,17,18) |
| InChIKey | GOQDQBWJMDRGCB-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 99.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |