4-(1,4-dimethylimidazol-2-yl)butanoic acid

C9H14N2O2 — CID 84658537

IUPAC4-(1,4-dimethylimidazol-2-yl)butanoic acid
SMILESCc1cn(C)c(CCCC(=O)O)n1
InChIInChI=1S/C9H14N2O2/c1-7-6-11(2)8(10-7)4-3-5-9(12)13/h6H,3-5H2,1-2H3,(H,12,13)
InChIKeyYBQXKEHSYOZECO-UHFFFAOYSA-N
MW182.22 g/mol
LogP1.14
Rot. Bonds4

About 4-(1,4-dimethylimidazol-2-yl)butanoic acid

4-(1,4-dimethylimidazol-2-yl)butanoic acid (PubChem CID 84658537) has the molecular formula C9H14N2O2 and a molecular weight of 182.22 g/mol. Its IUPAC name is 4-(1,4-dimethylimidazol-2-yl)butanoic acid.

Molecular Properties

Compound Name4-(1,4-dimethylimidazol-2-yl)butanoic acid
PubChem CID84658537
Molecular FormulaC9H14N2O2
Molecular Weight182.22 g/mol
Exact Mass182.11
IUPAC Name4-(1,4-dimethylimidazol-2-yl)butanoic acid
SMILESCc1cn(C)c(CCCC(=O)O)n1
InChIInChI=1S/C9H14N2O2/c1-7-6-11(2)8(10-7)4-3-5-9(12)13/h6H,3-5H2,1-2H3,(H,12,13)
InChIKeyYBQXKEHSYOZECO-UHFFFAOYSA-N
XLogP1.14
TPSA55.12 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500182.22
LogP ≤ 51.14
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 4-(1,4-dimethylimidazol-2-yl)butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(1,4-dimethylimidazol-2-yl)butanoic acid?
The IUPAC name of 4-(1,4-dimethylimidazol-2-yl)butanoic acid (CID 84658537) is 4-(1,4-dimethylimidazol-2-yl)butanoic acid.
What is the SMILES notation for 4-(1,4-dimethylimidazol-2-yl)butanoic acid?
The canonical SMILES for 4-(1,4-dimethylimidazol-2-yl)butanoic acid is Cc1cn(C)c(CCCC(=O)O)n1.
What is the InChIKey of 4-(1,4-dimethylimidazol-2-yl)butanoic acid?
The InChIKey is YBQXKEHSYOZECO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O2/c1-7-6-11(2)8(10-7)4-3-5-9(12)13/h6H,3-5H2,1-2H3,(H,12,13).
What are the key properties of 4-(1,4-dimethylimidazol-2-yl)butanoic acid?
4-(1,4-dimethylimidazol-2-yl)butanoic acid has a molecular weight of 182.22 g/mol, XLogP of 1.14, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,4-dimethylimidazol-2-yl)butanoic acid is sourced from PubChem (CID 84658537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).