C18H21BrN6O3 — CID 34527991
2-(8-bromo-1,3-dimethyl-2,6-dioxopurin-9-yl)-N-[[4-(dimethylamino)phenyl]methyl]acetamide (PubChem CID 34527991) has the molecular formula C18H21BrN6O3 and a molecular weight of 449.31 g/mol. Its IUPAC name is 2-(8-bromo-1,3-dimethyl-2,6-dioxopurin-9-yl)-N-[[4-(dimethylamino)phenyl]methyl]acetamide.
| Compound Name | 2-(8-bromo-1,3-dimethyl-2,6-dioxopurin-9-yl)-N-[[4-(dimethylamino)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 34527991 |
| Molecular Formula | C18H21BrN6O3 |
| Molecular Weight | 449.31 g/mol |
| Exact Mass | 448.09 |
| IUPAC Name | 2-(8-bromo-1,3-dimethyl-2,6-dioxopurin-9-yl)-N-[[4-(dimethylamino)phenyl]methyl]acetamide |
| SMILES | CN(C)c1ccc(CNC(=O)Cn2c(Br)nc3c(=O)n(C)c(=O)n(C)c32)cc1 |
| InChI | InChI=1S/C18H21BrN6O3/c1-22(2)12-7-5-11(6-8-12)9-20-13(26)10-25-15-14(21-17(25)19)16(27)24(4)18(28)23(15)3/h5-8H,9-10H2,1-4H3,(H,20,26) |
| InChIKey | FOLLTKPBNPLVAU-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 94.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.31 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|