C14H11ClFN5O4 — CID 8522662
9-[(2-chloro-6-fluorophenyl)methyl]-1,3-dimethyl-8-nitropurine-2,6-dione (PubChem CID 8522662) has the molecular formula C14H11ClFN5O4 and a molecular weight of 367.72 g/mol. Its IUPAC name is 9-[(2-chloro-6-fluorophenyl)methyl]-1,3-dimethyl-8-nitropurine-2,6-dione.
| Compound Name | 9-[(2-chloro-6-fluorophenyl)methyl]-1,3-dimethyl-8-nitropurine-2,6-dione |
|---|---|
| PubChem CID | 8522662 |
| Molecular Formula | C14H11ClFN5O4 |
| Molecular Weight | 367.72 g/mol |
| Exact Mass | 367.05 |
| IUPAC Name | 9-[(2-chloro-6-fluorophenyl)methyl]-1,3-dimethyl-8-nitropurine-2,6-dione |
| SMILES | Cn1c(=O)c2nc([N+](=O)[O-])n(Cc3c(F)cccc3Cl)c2n(C)c1=O |
| InChI | InChI=1S/C14H11ClFN5O4/c1-18-11-10(12(22)19(2)14(18)23)17-13(21(24)25)20(11)6-7-8(15)4-3-5-9(7)16/h3-5H,6H2,1-2H3 |
| InChIKey | XEIKFSISQZKAMD-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 104.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.72 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|