C18H21ClFN5O3 — CID 126476368
7-[(2-chloro-6-fluorophenyl)methyl]-8-(3-methoxypropylamino)-1,3-dimethylpurine-2,6-dione (PubChem CID 126476368) has the molecular formula C18H21ClFN5O3 and a molecular weight of 409.85 g/mol. Its IUPAC name is 7-[(2-chloro-6-fluorophenyl)methyl]-8-(3-methoxypropylamino)-1,3-dimethylpurine-2,6-dione.
| Compound Name | 7-[(2-chloro-6-fluorophenyl)methyl]-8-(3-methoxypropylamino)-1,3-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 126476368 |
| Molecular Formula | C18H21ClFN5O3 |
| Molecular Weight | 409.85 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | 7-[(2-chloro-6-fluorophenyl)methyl]-8-(3-methoxypropylamino)-1,3-dimethylpurine-2,6-dione |
| SMILES | COCCCNc1nc2c(c(=O)n(C)c(=O)n2C)n1Cc1c(F)cccc1Cl |
| InChI | InChI=1S/C18H21ClFN5O3/c1-23-15-14(16(26)24(2)18(23)27)25(17(22-15)21-8-5-9-28-3)10-11-12(19)6-4-7-13(11)20/h4,6-7H,5,8-10H2,1-3H3,(H,21,22) |
| InChIKey | FCFNNFKSGZNZKP-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 83.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.85 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|