C19H22ClFN6O3 — CID 43814404
N-[2-[[7-[(2-chloro-6-fluorophenyl)methyl]-1,3-dimethyl-2,6-dioxopurin-8-yl]amino]ethyl]propanamide (PubChem CID 43814404) has the molecular formula C19H22ClFN6O3 and a molecular weight of 436.88 g/mol. Its IUPAC name is N-[2-[[7-[(2-chloro-6-fluorophenyl)methyl]-1,3-dimethyl-2,6-dioxopurin-8-yl]amino]ethyl]propanamide.
| Compound Name | N-[2-[[7-[(2-chloro-6-fluorophenyl)methyl]-1,3-dimethyl-2,6-dioxopurin-8-yl]amino]ethyl]propanamide |
|---|---|
| PubChem CID | 43814404 |
| Molecular Formula | C19H22ClFN6O3 |
| Molecular Weight | 436.88 g/mol |
| Exact Mass | 436.14 |
| IUPAC Name | N-[2-[[7-[(2-chloro-6-fluorophenyl)methyl]-1,3-dimethyl-2,6-dioxopurin-8-yl]amino]ethyl]propanamide |
| SMILES | CCC(=O)NCCNc1nc2c(c(=O)n(C)c(=O)n2C)n1Cc1c(F)cccc1Cl |
| InChI | InChI=1S/C19H22ClFN6O3/c1-4-14(28)22-8-9-23-18-24-16-15(17(29)26(3)19(30)25(16)2)27(18)10-11-12(20)6-5-7-13(11)21/h5-7H,4,8-10H2,1-3H3,(H,22,28)(H,23,24) |
| InChIKey | ORUSRYDAQIPEGF-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.88 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|