C21H21FN6O3S — CID 3219840
N-[2-[[7-[(2-fluorophenyl)methyl]-1,3-dimethyl-2,6-dioxopurin-8-yl]amino]ethyl]thiophene-2-carboxamide (PubChem CID 3219840) has the molecular formula C21H21FN6O3S and a molecular weight of 456.50 g/mol. Its IUPAC name is N-[2-[[7-[(2-fluorophenyl)methyl]-1,3-dimethyl-2,6-dioxopurin-8-yl]amino]ethyl]thiophene-2-carboxamide.
| Compound Name | N-[2-[[7-[(2-fluorophenyl)methyl]-1,3-dimethyl-2,6-dioxopurin-8-yl]amino]ethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 3219840 |
| Molecular Formula | C21H21FN6O3S |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.14 |
| IUPAC Name | N-[2-[[7-[(2-fluorophenyl)methyl]-1,3-dimethyl-2,6-dioxopurin-8-yl]amino]ethyl]thiophene-2-carboxamide |
| SMILES | Cn1c(=O)c2c(nc(NCCNC(=O)c3cccs3)n2Cc2ccccc2F)n(C)c1=O |
| InChI | InChI=1S/C21H21FN6O3S/c1-26-17-16(19(30)27(2)21(26)31)28(12-13-6-3-4-7-14(13)22)20(25-17)24-10-9-23-18(29)15-8-5-11-32-15/h3-8,11H,9-10,12H2,1-2H3,(H,23,29)(H,24,25) |
| InChIKey | POIBBHYZLYLBGH-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|