C20H23FN6O3 — CID 43814353
N-[2-[[7-[(4-fluorophenyl)methyl]-1,3-dimethyl-2,6-dioxopurin-8-yl]amino]ethyl]cyclopropanecarboxamide (PubChem CID 43814353) has the molecular formula C20H23FN6O3 and a molecular weight of 414.44 g/mol. Its IUPAC name is N-[2-[[7-[(4-fluorophenyl)methyl]-1,3-dimethyl-2,6-dioxopurin-8-yl]amino]ethyl]cyclopropanecarboxamide.
| Compound Name | N-[2-[[7-[(4-fluorophenyl)methyl]-1,3-dimethyl-2,6-dioxopurin-8-yl]amino]ethyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 43814353 |
| Molecular Formula | C20H23FN6O3 |
| Molecular Weight | 414.44 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | N-[2-[[7-[(4-fluorophenyl)methyl]-1,3-dimethyl-2,6-dioxopurin-8-yl]amino]ethyl]cyclopropanecarboxamide |
| SMILES | Cn1c(=O)c2c(nc(NCCNC(=O)C3CC3)n2Cc2ccc(F)cc2)n(C)c1=O |
| InChI | InChI=1S/C20H23FN6O3/c1-25-16-15(18(29)26(2)20(25)30)27(11-12-3-7-14(21)8-4-12)19(24-16)23-10-9-22-17(28)13-5-6-13/h3-4,7-8,13H,5-6,9-11H2,1-2H3,(H,22,28)(H,23,24) |
| InChIKey | RYUYUFQAEJWRHY-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.44 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|