C18H22FN5O4 — CID 4874777
8-(2,2-dimethoxyethylamino)-7-[(4-fluorophenyl)methyl]-1,3-dimethylpurine-2,6-dione (PubChem CID 4874777) has the molecular formula C18H22FN5O4 and a molecular weight of 391.40 g/mol. Its IUPAC name is 8-(2,2-dimethoxyethylamino)-7-[(4-fluorophenyl)methyl]-1,3-dimethylpurine-2,6-dione.
| Compound Name | 8-(2,2-dimethoxyethylamino)-7-[(4-fluorophenyl)methyl]-1,3-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 4874777 |
| Molecular Formula | C18H22FN5O4 |
| Molecular Weight | 391.40 g/mol |
| Exact Mass | 391.17 |
| IUPAC Name | 8-(2,2-dimethoxyethylamino)-7-[(4-fluorophenyl)methyl]-1,3-dimethylpurine-2,6-dione |
| SMILES | COC(CNc1nc2c(c(=O)n(C)c(=O)n2C)n1Cc1ccc(F)cc1)OC |
| InChI | InChI=1S/C18H22FN5O4/c1-22-15-14(16(25)23(2)18(22)26)24(10-11-5-7-12(19)8-6-11)17(21-15)20-9-13(27-3)28-4/h5-8,13H,9-10H2,1-4H3,(H,20,21) |
| InChIKey | POACAUCEYXEYIV-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 92.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.40 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|