C21H25FN6O3 — CID 43814386
N-[2-[[7-[(4-fluorophenyl)methyl]-1,3-dimethyl-2,6-dioxopurin-8-yl]amino]ethyl]cyclobutanecarboxamide (PubChem CID 43814386) has the molecular formula C21H25FN6O3 and a molecular weight of 428.47 g/mol. Its IUPAC name is N-[2-[[7-[(4-fluorophenyl)methyl]-1,3-dimethyl-2,6-dioxopurin-8-yl]amino]ethyl]cyclobutanecarboxamide.
| Compound Name | N-[2-[[7-[(4-fluorophenyl)methyl]-1,3-dimethyl-2,6-dioxopurin-8-yl]amino]ethyl]cyclobutanecarboxamide |
|---|---|
| PubChem CID | 43814386 |
| Molecular Formula | C21H25FN6O3 |
| Molecular Weight | 428.47 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | N-[2-[[7-[(4-fluorophenyl)methyl]-1,3-dimethyl-2,6-dioxopurin-8-yl]amino]ethyl]cyclobutanecarboxamide |
| SMILES | Cn1c(=O)c2c(nc(NCCNC(=O)C3CCC3)n2Cc2ccc(F)cc2)n(C)c1=O |
| InChI | InChI=1S/C21H25FN6O3/c1-26-17-16(19(30)27(2)21(26)31)28(12-13-6-8-15(22)9-7-13)20(25-17)24-11-10-23-18(29)14-4-3-5-14/h6-9,14H,3-5,10-12H2,1-2H3,(H,23,29)(H,24,25) |
| InChIKey | QSBBFXHJFRHIKX-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.47 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|