C21H28N6O4 — CID 43814397
N-[2-[[7-[(2,5-dimethylphenyl)methyl]-1,3-dimethyl-2,6-dioxopurin-8-yl]amino]ethyl]-2-methoxyacetamide (PubChem CID 43814397) has the molecular formula C21H28N6O4 and a molecular weight of 428.49 g/mol. Its IUPAC name is N-[2-[[7-[(2,5-dimethylphenyl)methyl]-1,3-dimethyl-2,6-dioxopurin-8-yl]amino]ethyl]-2-methoxyacetamide.
| Compound Name | N-[2-[[7-[(2,5-dimethylphenyl)methyl]-1,3-dimethyl-2,6-dioxopurin-8-yl]amino]ethyl]-2-methoxyacetamide |
|---|---|
| PubChem CID | 43814397 |
| Molecular Formula | C21H28N6O4 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | N-[2-[[7-[(2,5-dimethylphenyl)methyl]-1,3-dimethyl-2,6-dioxopurin-8-yl]amino]ethyl]-2-methoxyacetamide |
| SMILES | COCC(=O)NCCNc1nc2c(c(=O)n(C)c(=O)n2C)n1Cc1cc(C)ccc1C |
| InChI | InChI=1S/C21H28N6O4/c1-13-6-7-14(2)15(10-13)11-27-17-18(25(3)21(30)26(4)19(17)29)24-20(27)23-9-8-22-16(28)12-31-5/h6-7,10H,8-9,11-12H2,1-5H3,(H,22,28)(H,23,24) |
| InChIKey | CHMFKDHYPUFRAK-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 112.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|