C18H19N5O5 — CID 9358629
1,3-dimethyl-8-nitro-9-[2-oxo-2-(4-propylphenyl)ethyl]purine-2,6-dione (PubChem CID 9358629) has the molecular formula C18H19N5O5 and a molecular weight of 385.38 g/mol. Its IUPAC name is 1,3-dimethyl-8-nitro-9-[2-oxo-2-(4-propylphenyl)ethyl]purine-2,6-dione.
| Compound Name | 1,3-dimethyl-8-nitro-9-[2-oxo-2-(4-propylphenyl)ethyl]purine-2,6-dione |
|---|---|
| PubChem CID | 9358629 |
| Molecular Formula | C18H19N5O5 |
| Molecular Weight | 385.38 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | 1,3-dimethyl-8-nitro-9-[2-oxo-2-(4-propylphenyl)ethyl]purine-2,6-dione |
| SMILES | CCCc1ccc(C(=O)Cn2c([N+](=O)[O-])nc3c(=O)n(C)c(=O)n(C)c32)cc1 |
| InChI | InChI=1S/C18H19N5O5/c1-4-5-11-6-8-12(9-7-11)13(24)10-22-15-14(19-17(22)23(27)28)16(25)21(3)18(26)20(15)2/h6-9H,4-5,10H2,1-3H3 |
| InChIKey | FRJZJEBERGFOOZ-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 122.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.38 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|