C16H13F2N5O5 — CID 9372935
9-[(2S)-1-(3,4-difluorophenyl)-1-oxopropan-2-yl]-1,3-dimethyl-8-nitropurine-2,6-dione (PubChem CID 9372935) has the molecular formula C16H13F2N5O5 and a molecular weight of 393.31 g/mol. Its IUPAC name is 9-[(2S)-1-(3,4-difluorophenyl)-1-oxopropan-2-yl]-1,3-dimethyl-8-nitropurine-2,6-dione.
| Compound Name | 9-[(2S)-1-(3,4-difluorophenyl)-1-oxopropan-2-yl]-1,3-dimethyl-8-nitropurine-2,6-dione |
|---|---|
| PubChem CID | 9372935 |
| Molecular Formula | C16H13F2N5O5 |
| Molecular Weight | 393.31 g/mol |
| Exact Mass | 393.09 |
| IUPAC Name | 9-[(2S)-1-(3,4-difluorophenyl)-1-oxopropan-2-yl]-1,3-dimethyl-8-nitropurine-2,6-dione |
| SMILES | C[C@@H](C(=O)c1ccc(F)c(F)c1)n1c([N+](=O)[O-])nc2c(=O)n(C)c(=O)n(C)c21 |
| InChI | InChI=1S/C16H13F2N5O5/c1-7(12(24)8-4-5-9(17)10(18)6-8)22-13-11(19-15(22)23(27)28)14(25)21(3)16(26)20(13)2/h4-7H,1-3H3/t7-/m0/s1 |
| InChIKey | OVQVCDFULXYITG-ZETCQYMHSA-N |
| XLogP | 1.06 |
| TPSA | 122.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.31 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|