C16H13F2NO4 — CID 8561805
(2R)-1-(3,4-difluorophenyl)-2-(4-methyl-2-nitrophenoxy)propan-1-one (PubChem CID 8561805) has the molecular formula C16H13F2NO4 and a molecular weight of 321.28 g/mol. Its IUPAC name is (2R)-1-(3,4-difluorophenyl)-2-(4-methyl-2-nitrophenoxy)propan-1-one.
| Compound Name | (2R)-1-(3,4-difluorophenyl)-2-(4-methyl-2-nitrophenoxy)propan-1-one |
|---|---|
| PubChem CID | 8561805 |
| Molecular Formula | C16H13F2NO4 |
| Molecular Weight | 321.28 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | (2R)-1-(3,4-difluorophenyl)-2-(4-methyl-2-nitrophenoxy)propan-1-one |
| SMILES | Cc1ccc(O[C@H](C)C(=O)c2ccc(F)c(F)c2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H13F2NO4/c1-9-3-6-15(14(7-9)19(21)22)23-10(2)16(20)11-4-5-12(17)13(18)8-11/h3-8,10H,1-2H3/t10-/m1/s1 |
| InChIKey | OPZGBHMEYVSDOA-SNVBAGLBSA-N |
| XLogP | 3.83 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.28 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|