C15H11F2NO4 — CID 7816846
(2R)-1-(3,4-difluorophenyl)-2-(4-nitrophenoxy)propan-1-one (PubChem CID 7816846) has the molecular formula C15H11F2NO4 and a molecular weight of 307.25 g/mol. Its IUPAC name is (2R)-1-(3,4-difluorophenyl)-2-(4-nitrophenoxy)propan-1-one.
| Compound Name | (2R)-1-(3,4-difluorophenyl)-2-(4-nitrophenoxy)propan-1-one |
|---|---|
| PubChem CID | 7816846 |
| Molecular Formula | C15H11F2NO4 |
| Molecular Weight | 307.25 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | (2R)-1-(3,4-difluorophenyl)-2-(4-nitrophenoxy)propan-1-one |
| SMILES | C[C@@H](Oc1ccc([N+](=O)[O-])cc1)C(=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C15H11F2NO4/c1-9(15(19)10-2-7-13(16)14(17)8-10)22-12-5-3-11(4-6-12)18(20)21/h2-9H,1H3/t9-/m1/s1 |
| InChIKey | AZMOQPYQGYUMKB-SECBINFHSA-N |
| XLogP | 3.52 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.25 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|