C16H14F2N2O4 — CID 86786828
1-[3-(3,4-difluorophenyl)-2-methyl-3-oxopropyl]-4-methyl-5-nitropyridin-2-one (PubChem CID 86786828) has the molecular formula C16H14F2N2O4 and a molecular weight of 336.29 g/mol. Its IUPAC name is 1-[3-(3,4-difluorophenyl)-2-methyl-3-oxopropyl]-4-methyl-5-nitropyridin-2-one.
| Compound Name | 1-[3-(3,4-difluorophenyl)-2-methyl-3-oxopropyl]-4-methyl-5-nitropyridin-2-one |
|---|---|
| PubChem CID | 86786828 |
| Molecular Formula | C16H14F2N2O4 |
| Molecular Weight | 336.29 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | 1-[3-(3,4-difluorophenyl)-2-methyl-3-oxopropyl]-4-methyl-5-nitropyridin-2-one |
| SMILES | Cc1cc(=O)n(CC(C)C(=O)c2ccc(F)c(F)c2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H14F2N2O4/c1-9-5-15(21)19(8-14(9)20(23)24)7-10(2)16(22)11-3-4-12(17)13(18)6-11/h3-6,8,10H,7H2,1-2H3 |
| InChIKey | BNRLYORGCGFJRT-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 82.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.29 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|