C16H15ClN4O2 — CID 133109922
8-[(Z)-1-chloro-2-phenylethenyl]-1,3,9-trimethylpurine-2,6-dione (PubChem CID 133109922) has the molecular formula C16H15ClN4O2 and a molecular weight of 330.78 g/mol. Its IUPAC name is 8-[(Z)-1-chloro-2-phenylethenyl]-1,3,9-trimethylpurine-2,6-dione.
| Compound Name | 8-[(Z)-1-chloro-2-phenylethenyl]-1,3,9-trimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 133109922 |
| Molecular Formula | C16H15ClN4O2 |
| Molecular Weight | 330.78 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | 8-[(Z)-1-chloro-2-phenylethenyl]-1,3,9-trimethylpurine-2,6-dione |
| SMILES | Cn1c(=O)c2nc(/C(Cl)=C/c3ccccc3)n(C)c2n(C)c1=O |
| InChI | InChI=1S/C16H15ClN4O2/c1-19-13(11(17)9-10-7-5-4-6-8-10)18-12-14(19)20(2)16(23)21(3)15(12)22/h4-9H,1-3H3/b11-9- |
| InChIKey | HHXXTGWYDLLWMK-LUAWRHEFSA-N |
| XLogP | 1.71 |
| TPSA | 61.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.78 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |