C12H12N4O3 — CID 102432253
8-(furan-2-yl)-1,3,9-trimethylpurine-2,6-dione (PubChem CID 102432253) has the molecular formula C12H12N4O3 and a molecular weight of 260.25 g/mol. Its IUPAC name is 8-(furan-2-yl)-1,3,9-trimethylpurine-2,6-dione.
| Compound Name | 8-(furan-2-yl)-1,3,9-trimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 102432253 |
| Molecular Formula | C12H12N4O3 |
| Molecular Weight | 260.25 g/mol |
| Exact Mass | 260.09 |
| IUPAC Name | 8-(furan-2-yl)-1,3,9-trimethylpurine-2,6-dione |
| SMILES | Cn1c(=O)c2nc(-c3ccco3)n(C)c2n(C)c1=O |
| InChI | InChI=1S/C12H12N4O3/c1-14-9(7-5-4-6-19-7)13-8-10(14)15(2)12(18)16(3)11(8)17/h4-6H,1-3H3 |
| InChIKey | XNFFNQCEFFSYDW-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 74.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.25 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |