C13H11N5O2S — CID 154720378
5-(1,3,9-trimethyl-2,6-dioxopurin-8-yl)thiophene-2-carbonitrile (PubChem CID 154720378) has the molecular formula C13H11N5O2S and a molecular weight of 301.33 g/mol. Its IUPAC name is 5-(1,3,9-trimethyl-2,6-dioxopurin-8-yl)thiophene-2-carbonitrile.
| Compound Name | 5-(1,3,9-trimethyl-2,6-dioxopurin-8-yl)thiophene-2-carbonitrile |
|---|---|
| PubChem CID | 154720378 |
| Molecular Formula | C13H11N5O2S |
| Molecular Weight | 301.33 g/mol |
| Exact Mass | 301.06 |
| IUPAC Name | 5-(1,3,9-trimethyl-2,6-dioxopurin-8-yl)thiophene-2-carbonitrile |
| SMILES | Cn1c(=O)c2nc(-c3ccc(C#N)s3)n(C)c2n(C)c1=O |
| InChI | InChI=1S/C13H11N5O2S/c1-16-10(8-5-4-7(6-14)21-8)15-9-11(16)17(2)13(20)18(3)12(9)19/h4-5H,1-3H3 |
| InChIKey | QSHVBMSPSZWVDI-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 85.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.33 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |