C27H24N4O2S — CID 101110525
ethyl 12,13-diphenyl-4-(propan-2-ylamino)-8-thia-3,10,11-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene-5-carboxylate (PubChem CID 101110525) has the molecular formula C27H24N4O2S and a molecular weight of 468.58 g/mol. Its IUPAC name is ethyl 12,13-diphenyl-4-(propan-2-ylamino)-8-thia-3,10,11-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene-5-carboxylate.
| Compound Name | ethyl 12,13-diphenyl-4-(propan-2-ylamino)-8-thia-3,10,11-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene-5-carboxylate |
|---|---|
| PubChem CID | 101110525 |
| Molecular Formula | C27H24N4O2S |
| Molecular Weight | 468.58 g/mol |
| Exact Mass | 468.16 |
| IUPAC Name | ethyl 12,13-diphenyl-4-(propan-2-ylamino)-8-thia-3,10,11-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene-5-carboxylate |
| SMILES | CCOC(=O)c1cc2sc3nnc(-c4ccccc4)c(-c4ccccc4)c3c2nc1NC(C)C |
| InChI | InChI=1S/C27H24N4O2S/c1-4-33-27(32)19-15-20-24(29-25(19)28-16(2)3)22-21(17-11-7-5-8-12-17)23(30-31-26(22)34-20)18-13-9-6-10-14-18/h5-16H,4H2,1-3H3,(H,28,29) |
| InChIKey | QMIITJLJSKVLJH-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.58 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |