C32H28O7S2 — CID 91551423
ethyl 6-hydroxy-7-[4-[2-(4-methylphenyl)sulfonyloxyethoxy]phenyl]-3-phenyl-1-benzothiophene-2-carboxylate (PubChem CID 91551423) has the molecular formula C32H28O7S2 and a molecular weight of 588.70 g/mol. Its IUPAC name is ethyl 6-hydroxy-7-[4-[2-(4-methylphenyl)sulfonyloxyethoxy]phenyl]-3-phenyl-1-benzothiophene-2-carboxylate.
| Compound Name | ethyl 6-hydroxy-7-[4-[2-(4-methylphenyl)sulfonyloxyethoxy]phenyl]-3-phenyl-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 91551423 |
| Molecular Formula | C32H28O7S2 |
| Molecular Weight | 588.70 g/mol |
| Exact Mass | 588.13 |
| IUPAC Name | ethyl 6-hydroxy-7-[4-[2-(4-methylphenyl)sulfonyloxyethoxy]phenyl]-3-phenyl-1-benzothiophene-2-carboxylate |
| SMILES | CCOC(=O)c1sc2c(-c3ccc(OCCOS(=O)(=O)c4ccc(C)cc4)cc3)c(O)ccc2c1-c1ccccc1 |
| InChI | InChI=1S/C32H28O7S2/c1-3-37-32(34)31-28(22-7-5-4-6-8-22)26-17-18-27(33)29(30(26)40-31)23-11-13-24(14-12-23)38-19-20-39-41(35,36)25-15-9-21(2)10-16-25/h4-18,33H,3,19-20H2,1-2H3 |
| InChIKey | VKHDBDCPRDMLGB-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.70 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|