C19H18N2O4S2 — CID 172762564
ethyl 4-methyl-5-pyridin-2-yl-3-(4-sulfamoylphenyl)thiophene-2-carboxylate (PubChem CID 172762564) has the molecular formula C19H18N2O4S2 and a molecular weight of 402.50 g/mol. Its IUPAC name is ethyl 4-methyl-5-pyridin-2-yl-3-(4-sulfamoylphenyl)thiophene-2-carboxylate.
| Compound Name | ethyl 4-methyl-5-pyridin-2-yl-3-(4-sulfamoylphenyl)thiophene-2-carboxylate |
|---|---|
| PubChem CID | 172762564 |
| Molecular Formula | C19H18N2O4S2 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.07 |
| IUPAC Name | ethyl 4-methyl-5-pyridin-2-yl-3-(4-sulfamoylphenyl)thiophene-2-carboxylate |
| SMILES | CCOC(=O)c1sc(-c2ccccn2)c(C)c1-c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C19H18N2O4S2/c1-3-25-19(22)18-16(13-7-9-14(10-8-13)27(20,23)24)12(2)17(26-18)15-6-4-5-11-21-15/h4-11H,3H2,1-2H3,(H2,20,23,24) |
| InChIKey | LWPVMZPLKZBUNY-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 99.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |