C24H24N2O2S — CID 22917330
4-[4,4-dimethyl-2-(4-pyridin-2-ylphenyl)cyclopenten-1-yl]benzenesulfonamide (PubChem CID 22917330) has the molecular formula C24H24N2O2S and a molecular weight of 404.54 g/mol. Its IUPAC name is 4-[4,4-dimethyl-2-(4-pyridin-2-ylphenyl)cyclopenten-1-yl]benzenesulfonamide.
| Compound Name | 4-[4,4-dimethyl-2-(4-pyridin-2-ylphenyl)cyclopenten-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 22917330 |
| Molecular Formula | C24H24N2O2S |
| Molecular Weight | 404.54 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | 4-[4,4-dimethyl-2-(4-pyridin-2-ylphenyl)cyclopenten-1-yl]benzenesulfonamide |
| SMILES | CC1(C)CC(c2ccc(-c3ccccn3)cc2)=C(c2ccc(S(N)(=O)=O)cc2)C1 |
| InChI | InChI=1S/C24H24N2O2S/c1-24(2)15-21(17-6-8-19(9-7-17)23-5-3-4-14-26-23)22(16-24)18-10-12-20(13-11-18)29(25,27)28/h3-14H,15-16H2,1-2H3,(H2,25,27,28) |
| InChIKey | ACWAWHJONZBYLB-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.54 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|