C21H23NO2S — CID 18934094
4-[6-(4-methylphenyl)spiro[3.4]oct-6-en-7-yl]benzenesulfonamide (PubChem CID 18934094) has the molecular formula C21H23NO2S and a molecular weight of 353.49 g/mol. Its IUPAC name is 4-[6-(4-methylphenyl)spiro[3.4]oct-6-en-7-yl]benzenesulfonamide.
| Compound Name | 4-[6-(4-methylphenyl)spiro[3.4]oct-6-en-7-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 18934094 |
| Molecular Formula | C21H23NO2S |
| Molecular Weight | 353.49 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | 4-[6-(4-methylphenyl)spiro[3.4]oct-6-en-7-yl]benzenesulfonamide |
| SMILES | Cc1ccc(C2=C(c3ccc(S(N)(=O)=O)cc3)CC3(CCC3)C2)cc1 |
| InChI | InChI=1S/C21H23NO2S/c1-15-3-5-16(6-4-15)19-13-21(11-2-12-21)14-20(19)17-7-9-18(10-8-17)25(22,23)24/h3-10H,2,11-14H2,1H3,(H2,22,23,24) |
| InChIKey | FOUDTKDFFCVWAA-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.49 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|