C20H17ClF3NO2S — CID 18933850
4-[6-[4-chloro-3-(trifluoromethyl)phenyl]spiro[2.4]hept-5-en-5-yl]benzenesulfonamide (PubChem CID 18933850) has the molecular formula C20H17ClF3NO2S and a molecular weight of 427.88 g/mol. Its IUPAC name is 4-[6-[4-chloro-3-(trifluoromethyl)phenyl]spiro[2.4]hept-5-en-5-yl]benzenesulfonamide.
| Compound Name | 4-[6-[4-chloro-3-(trifluoromethyl)phenyl]spiro[2.4]hept-5-en-5-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 18933850 |
| Molecular Formula | C20H17ClF3NO2S |
| Molecular Weight | 427.88 g/mol |
| Exact Mass | 427.06 |
| IUPAC Name | 4-[6-[4-chloro-3-(trifluoromethyl)phenyl]spiro[2.4]hept-5-en-5-yl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(C2=C(c3ccc(Cl)c(C(F)(F)F)c3)CC3(CC3)C2)cc1 |
| InChI | InChI=1S/C20H17ClF3NO2S/c21-18-6-3-13(9-17(18)20(22,23)24)16-11-19(7-8-19)10-15(16)12-1-4-14(5-2-12)28(25,26)27/h1-6,9H,7-8,10-11H2,(H2,25,26,27) |
| InChIKey | AKURRKJKXARCMR-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.88 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|